C21H24FN5O2S — CID 22250490
2-[3-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]propyl]tetrazole (PubChem CID 22250490) has the molecular formula C21H24FN5O2S and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[3-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]propyl]tetrazole.
| Compound Name | 2-[3-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]propyl]tetrazole |
|---|---|
| PubChem CID | 22250490 |
| Molecular Formula | C21H24FN5O2S |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-[3-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]propyl]tetrazole |
| SMILES | Cc1ccc(S(=O)(=O)N2C(CCCn3ncnn3)CCC2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H24FN5O2S/c1-16-4-11-20(12-5-16)30(28,29)27-19(3-2-14-26-24-15-23-25-26)10-13-21(27)17-6-8-18(22)9-7-17/h4-9,11-12,15,19,21H,2-3,10,13-14H2,1H3 |
| InChIKey | PWEFEVWCUZEYDD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |