C22H28FNO3S — CID 10201316
2-(4-fluorophenyl)-5-(4-methoxybutyl)-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 10201316) has the molecular formula C22H28FNO3S and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-(4-methoxybutyl)-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-(4-fluorophenyl)-5-(4-methoxybutyl)-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 10201316 |
| Molecular Formula | C22H28FNO3S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 2-(4-fluorophenyl)-5-(4-methoxybutyl)-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | COCCCCC1CCC(c2ccc(F)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H28FNO3S/c1-17-6-13-21(14-7-17)28(25,26)24-20(5-3-4-16-27-2)12-15-22(24)18-8-10-19(23)11-9-18/h6-11,13-14,20,22H,3-5,12,15-16H2,1-2H3 |
| InChIKey | CUGJJAHJRATQLU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|