C17H15ClO3S — CID 124858670
(1S,2S,3S)-2-(4-chlorophenyl)sulfonyl-3-(4-methylphenyl)cyclopropane-1-carbaldehyde (PubChem CID 124858670) has the molecular formula C17H15ClO3S and a molecular weight of 334.82 g/mol. Its IUPAC name is (1S,2S,3S)-2-(4-chlorophenyl)sulfonyl-3-(4-methylphenyl)cyclopropane-1-carbaldehyde.
| Compound Name | (1S,2S,3S)-2-(4-chlorophenyl)sulfonyl-3-(4-methylphenyl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 124858670 |
| Molecular Formula | C17H15ClO3S |
| Molecular Weight | 334.82 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | (1S,2S,3S)-2-(4-chlorophenyl)sulfonyl-3-(4-methylphenyl)cyclopropane-1-carbaldehyde |
| SMILES | Cc1ccc([C@@H]2[C@@H](C=O)[C@H]2S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H15ClO3S/c1-11-2-4-12(5-3-11)16-15(10-19)17(16)22(20,21)14-8-6-13(18)7-9-14/h2-10,15-17H,1H3/t15-,16-,17-/m1/s1 |
| InChIKey | QKGKLUQMQDJVJF-BRWVUGGUSA-N |
| XLogP | 3.40 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|