C15H13Cl2NO2S — CID 102570777
2-(4-chlorophenyl)-3-(4-chlorophenyl)sulfonylcyclopropan-1-amine (PubChem CID 102570777) has the molecular formula C15H13Cl2NO2S and a molecular weight of 342.25 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-chlorophenyl)sulfonylcyclopropan-1-amine.
| Compound Name | 2-(4-chlorophenyl)-3-(4-chlorophenyl)sulfonylcyclopropan-1-amine |
|---|---|
| PubChem CID | 102570777 |
| Molecular Formula | C15H13Cl2NO2S |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-chlorophenyl)sulfonylcyclopropan-1-amine |
| SMILES | NC1C(c2ccc(Cl)cc2)C1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2NO2S/c16-10-3-1-9(2-4-10)13-14(18)15(13)21(19,20)12-7-5-11(17)6-8-12/h1-8,13-15H,18H2 |
| InChIKey | LCTJGKALHGAFFD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |