C16H11Cl2NO2S — CID 102570871
2-(4-chlorophenyl)-3-(4-chlorophenyl)sulfonylcyclopropane-1-carbonitrile (PubChem CID 102570871) has the molecular formula C16H11Cl2NO2S and a molecular weight of 352.24 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(4-chlorophenyl)sulfonylcyclopropane-1-carbonitrile.
| Compound Name | 2-(4-chlorophenyl)-3-(4-chlorophenyl)sulfonylcyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 102570871 |
| Molecular Formula | C16H11Cl2NO2S |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 350.99 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(4-chlorophenyl)sulfonylcyclopropane-1-carbonitrile |
| SMILES | N#CC1C(c2ccc(Cl)cc2)C1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H11Cl2NO2S/c17-11-3-1-10(2-4-11)15-14(9-19)16(15)22(20,21)13-7-5-12(18)6-8-13/h1-8,14-16H |
| InChIKey | YCPCKJAXKFKTQH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |