C17H16ClNO2S2 — CID 124858872
(1S,2S,3S)-2-(4-chlorophenyl)sulfonyl-3-(4-methylphenyl)cyclopropane-1-carbothioamide (PubChem CID 124858872) has the molecular formula C17H16ClNO2S2 and a molecular weight of 365.91 g/mol. Its IUPAC name is (1S,2S,3S)-2-(4-chlorophenyl)sulfonyl-3-(4-methylphenyl)cyclopropane-1-carbothioamide.
| Compound Name | (1S,2S,3S)-2-(4-chlorophenyl)sulfonyl-3-(4-methylphenyl)cyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 124858872 |
| Molecular Formula | C17H16ClNO2S2 |
| Molecular Weight | 365.91 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | (1S,2S,3S)-2-(4-chlorophenyl)sulfonyl-3-(4-methylphenyl)cyclopropane-1-carbothioamide |
| SMILES | Cc1ccc([C@@H]2[C@H](C(N)=S)[C@H]2S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H16ClNO2S2/c1-10-2-4-11(5-3-10)14-15(17(19)22)16(14)23(20,21)13-8-6-12(18)7-9-13/h2-9,14-16H,1H3,(H2,19,22)/t14-,15+,16+/m1/s1 |
| InChIKey | SIMHAXWYCPSEJQ-PMPSAXMXSA-N |
| XLogP | 3.49 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.91 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|