C12H15NO2S2 — CID 124857470
(1R,2S,3S)-2-(4-methylphenyl)-3-methylsulfonylcyclopropane-1-carbothioamide (PubChem CID 124857470) has the molecular formula C12H15NO2S2 and a molecular weight of 269.39 g/mol. Its IUPAC name is (1R,2S,3S)-2-(4-methylphenyl)-3-methylsulfonylcyclopropane-1-carbothioamide.
| Compound Name | (1R,2S,3S)-2-(4-methylphenyl)-3-methylsulfonylcyclopropane-1-carbothioamide |
|---|---|
| PubChem CID | 124857470 |
| Molecular Formula | C12H15NO2S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (1R,2S,3S)-2-(4-methylphenyl)-3-methylsulfonylcyclopropane-1-carbothioamide |
| SMILES | Cc1ccc([C@@H]2[C@@H](C(N)=S)[C@H]2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C12H15NO2S2/c1-7-3-5-8(6-4-7)9-10(12(13)16)11(9)17(2,14)15/h3-6,9-11H,1-2H3,(H2,13,16)/t9-,10-,11+/m1/s1 |
| InChIKey | CWCVUWDYUDWOFN-MXWKQRLJSA-N |
| XLogP | 1.41 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|