C21H23NO4 — CID 130368600
dimethyl 2-(4-aminophenyl)-4-(4-methylphenyl)cyclobutane-1,3-dicarboxylate (PubChem CID 130368600) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is dimethyl 2-(4-aminophenyl)-4-(4-methylphenyl)cyclobutane-1,3-dicarboxylate.
| Compound Name | dimethyl 2-(4-aminophenyl)-4-(4-methylphenyl)cyclobutane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 130368600 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | dimethyl 2-(4-aminophenyl)-4-(4-methylphenyl)cyclobutane-1,3-dicarboxylate |
| SMILES | COC(=O)C1C(c2ccc(C)cc2)C(C(=O)OC)C1c1ccc(N)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-12-4-6-13(7-5-12)16-18(20(23)25-2)17(19(16)21(24)26-3)14-8-10-15(22)11-9-14/h4-11,16-19H,22H2,1-3H3 |
| InChIKey | OEAIQYMLYCIAET-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|