C11H13NO2 — CID 124585525
trans-methyl (1S,2S)-2-(4-aminophenyl)cyclopropane-1-carboxylate (PubChem CID 124585525) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-(4-aminophenyl)cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-(4-aminophenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 124585525 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | trans-methyl (1S,2S)-2-(4-aminophenyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]1c1ccc(N)cc1 |
| InChI | InChI=1S/C11H13NO2/c1-14-11(13)10-6-9(10)7-2-4-8(12)5-3-7/h2-5,9-10H,6,12H2,1H3/t9-,10+/m1/s1 |
| InChIKey | ABLMNIKWSKUYMA-ZJUUUORDSA-N |
| XLogP | 1.55 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|