C14H18O4 — CID 72544165
trans-methyl (1S,2S)-2-[4-(dimethoxymethyl)phenyl]cyclopropane-1-carboxylate (PubChem CID 72544165) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-[4-(dimethoxymethyl)phenyl]cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-[4-(dimethoxymethyl)phenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 72544165 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | trans-methyl (1S,2S)-2-[4-(dimethoxymethyl)phenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]1c1ccc(C(OC)OC)cc1 |
| InChI | InChI=1S/C14H18O4/c1-16-13(15)12-8-11(12)9-4-6-10(7-5-9)14(17-2)18-3/h4-7,11-12,14H,8H2,1-3H3/t11-,12+/m1/s1 |
| InChIKey | DWOZFNYTICWRCD-NEPJUHHUSA-N |
| XLogP | 2.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|