C13H12O2 — CID 124564799
trans-methyl (1S,2S)-2-(4-ethynylphenyl)cyclopropane-1-carboxylate (PubChem CID 124564799) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-(4-ethynylphenyl)cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-(4-ethynylphenyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 124564799 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | trans-methyl (1S,2S)-2-(4-ethynylphenyl)cyclopropane-1-carboxylate |
| SMILES | C#Cc1ccc([C@H]2C[C@@H]2C(=O)OC)cc1 |
| InChI | InChI=1S/C13H12O2/c1-3-9-4-6-10(7-5-9)11-8-12(11)13(14)15-2/h1,4-7,11-12H,8H2,2H3/t11-,12+/m1/s1 |
| InChIKey | AZQAYVKBWQEJJC-NEPJUHHUSA-N |
| XLogP | 1.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|