C19H17O4- — CID 6921319
cis-(2S,4R)-3-methoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylate (PubChem CID 6921319) has the molecular formula C19H17O4- and a molecular weight of 309.34 g/mol. Its IUPAC name is cis-(2S,4R)-3-methoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylate.
| Compound Name | cis-(2S,4R)-3-methoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 6921319 |
| Molecular Formula | C19H17O4- |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | cis-(2S,4R)-3-methoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylate |
| SMILES | COC(=O)C1[C@H](c2ccccc2)C(C(=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H18O4/c1-23-19(22)17-14(12-8-4-2-5-9-12)16(18(20)21)15(17)13-10-6-3-7-11-13/h2-11,14-17H,1H3,(H,20,21)/p-1/t14-,15+,16?,17? |
| InChIKey | TWVUUWMGOMIING-RYTJFDOTSA-M |
| XLogP | 1.72 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |