C21H23NO4 — CID 13169497
dimethyl (2R,3S,4S,5R)-1-methyl-2,5-diphenylpyrrolidine-3,4-dicarboxylate (PubChem CID 13169497) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is dimethyl (2R,3S,4S,5R)-1-methyl-2,5-diphenylpyrrolidine-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,3S,4S,5R)-1-methyl-2,5-diphenylpyrrolidine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 13169497 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | dimethyl (2R,3S,4S,5R)-1-methyl-2,5-diphenylpyrrolidine-3,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C(=O)OC)[C@H](c2ccccc2)N(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23NO4/c1-22-18(14-10-6-4-7-11-14)16(20(23)25-2)17(21(24)26-3)19(22)15-12-8-5-9-13-15/h4-13,16-19H,1-3H3/t16-,17-,18-,19-/m0/s1 |
| InChIKey | DANHQNPBAHKDQM-VJANTYMQSA-N |
| XLogP | 2.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |