C14H17NO4 — CID 23266537
methyl (2S,3S)-1-(3-methoxy-3-oxopropyl)-3-phenylaziridine-2-carboxylate (PubChem CID 23266537) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is methyl (2S,3S)-1-(3-methoxy-3-oxopropyl)-3-phenylaziridine-2-carboxylate.
| Compound Name | methyl (2S,3S)-1-(3-methoxy-3-oxopropyl)-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 23266537 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | methyl (2S,3S)-1-(3-methoxy-3-oxopropyl)-3-phenylaziridine-2-carboxylate |
| SMILES | COC(=O)CCN1[C@H](C(=O)OC)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-18-11(16)8-9-15-12(13(15)14(17)19-2)10-6-4-3-5-7-10/h3-7,12-13H,8-9H2,1-2H3/t12-,13-,15?/m0/s1 |
| InChIKey | LOEUGSLBOTVFSW-QNIGDANOSA-N |
| XLogP | 1.15 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|