C18H14N2O4 — CID 11186331
methyl (2S,3R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylaziridine-2-carboxylate (PubChem CID 11186331) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is methyl (2S,3R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylaziridine-2-carboxylate.
| Compound Name | methyl (2S,3R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 11186331 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | methyl (2S,3R)-1-(1,3-dioxoisoindol-2-yl)-3-phenylaziridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)N1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14N2O4/c1-24-18(23)15-14(11-7-3-2-4-8-11)19(15)20-16(21)12-9-5-6-10-13(12)17(20)22/h2-10,14-15H,1H3/t14-,15+,19?/m1/s1 |
| InChIKey | MPGBLQZAVNOLNL-DALSXFDMSA-N |
| XLogP | 1.80 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|