C13H11BrN2O4 — CID 4196861
methyl 3-(bromomethyl)-1-(1,3-dioxoisoindol-2-yl)aziridine-2-carboxylate (PubChem CID 4196861) has the molecular formula C13H11BrN2O4 and a molecular weight of 339.15 g/mol. Its IUPAC name is methyl 3-(bromomethyl)-1-(1,3-dioxoisoindol-2-yl)aziridine-2-carboxylate.
| Compound Name | methyl 3-(bromomethyl)-1-(1,3-dioxoisoindol-2-yl)aziridine-2-carboxylate |
|---|---|
| PubChem CID | 4196861 |
| Molecular Formula | C13H11BrN2O4 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | methyl 3-(bromomethyl)-1-(1,3-dioxoisoindol-2-yl)aziridine-2-carboxylate |
| SMILES | COC(=O)C1C(CBr)N1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11BrN2O4/c1-20-13(19)10-9(6-14)15(10)16-11(17)7-4-2-3-5-8(7)12(16)18/h2-5,9-10H,6H2,1H3 |
| InChIKey | SILWPUNSWZQLOD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|