C14H13NO4 — CID 1239910
cis-methyl (1S,2S)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclopropane-1-carboxylate (PubChem CID 1239910) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is cis-methyl (1S,2S)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1S,2S)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 1239910 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | cis-methyl (1S,2S)-2-[(1,3-dioxoisoindol-2-yl)methyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H13NO4/c1-19-14(18)11-6-8(11)7-15-12(16)9-4-2-3-5-10(9)13(15)17/h2-5,8,11H,6-7H2,1H3/t8-,11+/m1/s1 |
| InChIKey | IFIYPHPJWFMYAK-KCJUWKMLSA-N |
| XLogP | 1.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|