C16H23NO4 — CID 159386975
methane;methyl acetate;2-(2-methylpropyl)isoindole-1,3-dione (PubChem CID 159386975) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is methane;methyl acetate;2-(2-methylpropyl)isoindole-1,3-dione.
| Compound Name | methane;methyl acetate;2-(2-methylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 159386975 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methane;methyl acetate;2-(2-methylpropyl)isoindole-1,3-dione |
| SMILES | C.CC(C)CN1C(=O)c2ccccc2C1=O.COC(C)=O |
| InChI | InChI=1S/C12H13NO2.C3H6O2.CH4/c1-8(2)7-13-11(14)9-5-3-4-6-10(9)12(13)15;1-3(4)5-2;/h3-6,8H,7H2,1-2H3;1-2H3;1H4 |
| InChIKey | LLPTXPKFJFVILC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|