C18H14INO4 — CID 167019726
methyl 3-(1,3-dioxoisoindol-2-yl)-2-(4-iodophenyl)propanoate (PubChem CID 167019726) has the molecular formula C18H14INO4 and a molecular weight of 435.22 g/mol. Its IUPAC name is methyl 3-(1,3-dioxoisoindol-2-yl)-2-(4-iodophenyl)propanoate.
| Compound Name | methyl 3-(1,3-dioxoisoindol-2-yl)-2-(4-iodophenyl)propanoate |
|---|---|
| PubChem CID | 167019726 |
| Molecular Formula | C18H14INO4 |
| Molecular Weight | 435.22 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | methyl 3-(1,3-dioxoisoindol-2-yl)-2-(4-iodophenyl)propanoate |
| SMILES | COC(=O)C(CN1C(=O)c2ccccc2C1=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C18H14INO4/c1-24-18(23)15(11-6-8-12(19)9-7-11)10-20-16(21)13-4-2-3-5-14(13)17(20)22/h2-9,15H,10H2,1H3 |
| InChIKey | PKTNBSNDFAQFNL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|