C18H15NO5 — CID 102005725
(2S)-3-(1,3-dioxoisoindol-2-yl)-2-(4-methoxyphenyl)propanoic acid (PubChem CID 102005725) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is (2S)-3-(1,3-dioxoisoindol-2-yl)-2-(4-methoxyphenyl)propanoic acid.
| Compound Name | (2S)-3-(1,3-dioxoisoindol-2-yl)-2-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 102005725 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (2S)-3-(1,3-dioxoisoindol-2-yl)-2-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc([C@@H](CN2C(=O)c3ccccc3C2=O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H15NO5/c1-24-12-8-6-11(7-9-12)15(18(22)23)10-19-16(20)13-4-2-3-5-14(13)17(19)21/h2-9,15H,10H2,1H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | MSEWENLMCILWQF-OAHLLOKOSA-N |
| XLogP | 2.16 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|