C18H18N2O4 — CID 171988818
2-[2-hydroxy-3-(4-methoxyanilino)propyl]isoindole-1,3-dione (PubChem CID 171988818) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(4-methoxyanilino)propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-hydroxy-3-(4-methoxyanilino)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 171988818 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[2-hydroxy-3-(4-methoxyanilino)propyl]isoindole-1,3-dione |
| SMILES | COc1ccc(NCC(O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-24-14-8-6-12(7-9-14)19-10-13(21)11-20-17(22)15-4-2-3-5-16(15)18(20)23/h2-9,13,19,21H,10-11H2,1H3 |
| InChIKey | CBTWQPMELNXTIL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|