C28H24N2O8 — CID 1102637
2-[(2S)-3-[4-[(2R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropoxy]phenoxy]-2-hydroxypropyl]isoindole-1,3-dione (PubChem CID 1102637) has the molecular formula C28H24N2O8 and a molecular weight of 516.51 g/mol. Its IUPAC name is 2-[(2S)-3-[4-[(2R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropoxy]phenoxy]-2-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-3-[4-[(2R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropoxy]phenoxy]-2-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1102637 |
| Molecular Formula | C28H24N2O8 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 2-[(2S)-3-[4-[(2R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropoxy]phenoxy]-2-hydroxypropyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H](O)COc1ccc(OC[C@H](O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C28H24N2O8/c31-17(13-29-25(33)21-5-1-2-6-22(21)26(29)34)15-37-19-9-11-20(12-10-19)38-16-18(32)14-30-27(35)23-7-3-4-8-24(23)28(30)36/h1-12,17-18,31-32H,13-16H2/t17-,18+ |
| InChIKey | BQAAKMXRAKNJDO-HDICACEKSA-N |
| XLogP | 1.76 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|