C14H15NO4 — CID 101088829
2-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]isoindole-1,3-dione (PubChem CID 101088829) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101088829 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2-[(2S)-2-hydroxy-3-prop-2-enoxypropyl]isoindole-1,3-dione |
| SMILES | C=CCOC[C@@H](O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H15NO4/c1-2-7-19-9-10(16)8-15-13(17)11-5-3-4-6-12(11)14(15)18/h2-6,10,16H,1,7-9H2/t10-/m0/s1 |
| InChIKey | QZIVOEZZDSTJBP-JTQLQIEISA-N |
| XLogP | 0.85 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|