C18H14N2O4 — CID 140774849
2-[(2R)-2-hydroxy-3-(4-isocyanophenoxy)propyl]isoindole-1,3-dione (PubChem CID 140774849) has the molecular formula C18H14N2O4 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-[(2R)-2-hydroxy-3-(4-isocyanophenoxy)propyl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-2-hydroxy-3-(4-isocyanophenoxy)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 140774849 |
| Molecular Formula | C18H14N2O4 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-[(2R)-2-hydroxy-3-(4-isocyanophenoxy)propyl]isoindole-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(OC[C@H](O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H14N2O4/c1-19-12-6-8-14(9-7-12)24-11-13(21)10-20-17(22)15-4-2-3-5-16(15)18(20)23/h2-9,13,21H,10-11H2/t13-/m1/s1 |
| InChIKey | JOUBHKHTVZZUOE-CYBMUJFWSA-N |
| XLogP | 2.27 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|