C16H15NO5S — CID 3386011
2-(2-hydroxy-3-phenoxypropyl)-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 3386011) has the molecular formula C16H15NO5S and a molecular weight of 333.37 g/mol. Its IUPAC name is 2-(2-hydroxy-3-phenoxypropyl)-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-(2-hydroxy-3-phenoxypropyl)-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 3386011 |
| Molecular Formula | C16H15NO5S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-(2-hydroxy-3-phenoxypropyl)-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CC(O)COc1ccccc1 |
| InChI | InChI=1S/C16H15NO5S/c18-12(11-22-13-6-2-1-3-7-13)10-17-16(19)14-8-4-5-9-15(14)23(17,20)21/h1-9,12,18H,10-11H2 |
| InChIKey | YQQODIFFLURVNQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |