C16H16N2O4S — CID 135404059
1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-phenoxypropan-2-ol (PubChem CID 135404059) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is 1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-phenoxypropan-2-ol.
| Compound Name | 1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 135404059 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-3-phenoxypropan-2-ol |
| SMILES | O=S1(=O)N/C(=N\CC(O)COc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C16H16N2O4S/c19-12(11-22-13-6-2-1-3-7-13)10-17-16-14-8-4-5-9-15(14)23(20,21)18-16/h1-9,12,19H,10-11H2,(H,17,18) |
| InChIKey | AXIQZPWUCQHXLF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|