C18H16F3N3O4S — CID 135569837
3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-(2,2,2-trifluoroethoxy)phenyl]propanamide (PubChem CID 135569837) has the molecular formula C18H16F3N3O4S and a molecular weight of 427.40 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-(2,2,2-trifluoroethoxy)phenyl]propanamide.
| Compound Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-(2,2,2-trifluoroethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 135569837 |
| Molecular Formula | C18H16F3N3O4S |
| Molecular Weight | 427.40 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-N-[4-(2,2,2-trifluoroethoxy)phenyl]propanamide |
| SMILES | O=C(CC/N=C1\NS(=O)(=O)c2ccccc21)Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3N3O4S/c19-18(20,21)11-28-13-7-5-12(6-8-13)23-16(25)9-10-22-17-14-3-1-2-4-15(14)29(26,27)24-17/h1-8H,9-11H2,(H,22,24)(H,23,25) |
| InChIKey | HRXGMLCNGKXESS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|