C23H28N2O6 — CID 21236411
1,3-bis(2-hydroxy-3-phenoxypropyl)-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 21236411) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is 1,3-bis(2-hydroxy-3-phenoxypropyl)-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1,3-bis(2-hydroxy-3-phenoxypropyl)-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21236411 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1,3-bis(2-hydroxy-3-phenoxypropyl)-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(CC(O)COc2ccccc2)C(=O)N1CC(O)COc1ccccc1 |
| InChI | InChI=1S/C23H28N2O6/c1-23(2)21(28)24(13-17(26)15-30-19-9-5-3-6-10-19)22(29)25(23)14-18(27)16-31-20-11-7-4-8-12-20/h3-12,17-18,26-27H,13-16H2,1-2H3 |
| InChIKey | ANWSJCRGPHPJPU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|