C23H24N6O14 — CID 21238505
1,3-bis[3-(2,4-dinitrophenoxy)-2-hydroxypropyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 21238505) has the molecular formula C23H24N6O14 and a molecular weight of 608.47 g/mol. Its IUPAC name is 1,3-bis[3-(2,4-dinitrophenoxy)-2-hydroxypropyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1,3-bis[3-(2,4-dinitrophenoxy)-2-hydroxypropyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21238505 |
| Molecular Formula | C23H24N6O14 |
| Molecular Weight | 608.47 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | 1,3-bis[3-(2,4-dinitrophenoxy)-2-hydroxypropyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)N(CC(O)COc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)N1CC(O)COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N6O14/c1-23(2)21(32)24(9-15(30)11-42-19-5-3-13(26(34)35)7-17(19)28(38)39)22(33)25(23)10-16(31)12-43-20-6-4-14(27(36)37)8-18(20)29(40)41/h3-8,15-16,30-31H,9-12H2,1-2H3 |
| InChIKey | WVYHBZGERUOQSU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 272.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|