C9H9N5O6 — CID 134846797
1-azido-3-(2,4-dinitrophenoxy)propan-2-ol (PubChem CID 134846797) has the molecular formula C9H9N5O6 and a molecular weight of 283.20 g/mol. Its IUPAC name is 1-azido-3-(2,4-dinitrophenoxy)propan-2-ol.
| Compound Name | 1-azido-3-(2,4-dinitrophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 134846797 |
| Molecular Formula | C9H9N5O6 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 1-azido-3-(2,4-dinitrophenoxy)propan-2-ol |
| SMILES | [N-]=[N+]=NCC(O)COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N5O6/c10-12-11-4-7(15)5-20-9-2-1-6(13(16)17)3-8(9)14(18)19/h1-3,7,15H,4-5H2 |
| InChIKey | ATMQMTMYTKTZHB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|