C9H11N2O9P — CID 22763290
[3-(2,4-dinitrophenoxy)-2-hydroxypropyl]phosphonic acid (PubChem CID 22763290) has the molecular formula C9H11N2O9P and a molecular weight of 322.17 g/mol. Its IUPAC name is [3-(2,4-dinitrophenoxy)-2-hydroxypropyl]phosphonic acid.
| Compound Name | [3-(2,4-dinitrophenoxy)-2-hydroxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 22763290 |
| Molecular Formula | C9H11N2O9P |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | [3-(2,4-dinitrophenoxy)-2-hydroxypropyl]phosphonic acid |
| SMILES | O=[N+]([O-])c1ccc(OCC(O)CP(=O)(O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H11N2O9P/c12-7(5-21(17,18)19)4-20-9-2-1-6(10(13)14)3-8(9)11(15)16/h1-3,7,12H,4-5H2,(H2,17,18,19) |
| InChIKey | JTHXFVKQKYPAOK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 173.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|