C10H15N3O12P2 — CID 22763376
[4-(2,4-dinitrophenoxy)-1-(phosphonooxyamino)butan-2-yl]phosphonic acid (PubChem CID 22763376) has the molecular formula C10H15N3O12P2 and a molecular weight of 431.19 g/mol. Its IUPAC name is [4-(2,4-dinitrophenoxy)-1-(phosphonooxyamino)butan-2-yl]phosphonic acid.
| Compound Name | [4-(2,4-dinitrophenoxy)-1-(phosphonooxyamino)butan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 22763376 |
| Molecular Formula | C10H15N3O12P2 |
| Molecular Weight | 431.19 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | [4-(2,4-dinitrophenoxy)-1-(phosphonooxyamino)butan-2-yl]phosphonic acid |
| SMILES | O=[N+]([O-])c1ccc(OCCC(CNOP(=O)(O)O)P(=O)(O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H15N3O12P2/c14-12(15)7-1-2-10(9(5-7)13(16)17)24-4-3-8(26(18,19)20)6-11-25-27(21,22)23/h1-2,5,8,11H,3-4,6H2,(H2,18,19,20)(H2,21,22,23) |
| InChIKey | QIMOBIDYYBGVPA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 231.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|