C14H9Cl2N3O7 — CID 17359401
N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,4-dinitrophenoxy)acetamide (PubChem CID 17359401) has the molecular formula C14H9Cl2N3O7 and a molecular weight of 402.15 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,4-dinitrophenoxy)acetamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,4-dinitrophenoxy)acetamide |
|---|---|
| PubChem CID | 17359401 |
| Molecular Formula | C14H9Cl2N3O7 |
| Molecular Weight | 402.15 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)-2-(2,4-dinitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2N3O7/c15-9-3-7(4-10(16)14(9)21)17-13(20)6-26-12-2-1-8(18(22)23)5-11(12)19(24)25/h1-5,21H,6H2,(H,17,20) |
| InChIKey | AAEYVGFQMYEPJO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 144.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|