C11H13N3O7 — CID 17359083
2-(2,4-dinitrophenoxy)-N-(2-methoxyethyl)acetamide (PubChem CID 17359083) has the molecular formula C11H13N3O7 and a molecular weight of 299.24 g/mol. Its IUPAC name is 2-(2,4-dinitrophenoxy)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(2,4-dinitrophenoxy)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 17359083 |
| Molecular Formula | C11H13N3O7 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(2,4-dinitrophenoxy)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)COc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O7/c1-20-5-4-12-11(15)7-21-10-3-2-8(13(16)17)6-9(10)14(18)19/h2-3,6H,4-5,7H2,1H3,(H,12,15) |
| InChIKey | IXWJMQILDMUAKE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|