C18H15N3O10 — CID 17358902
dimethyl 5-[[2-(2,4-dinitrophenoxy)acetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 17358902) has the molecular formula C18H15N3O10 and a molecular weight of 433.33 g/mol. Its IUPAC name is dimethyl 5-[[2-(2,4-dinitrophenoxy)acetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(2,4-dinitrophenoxy)acetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 17358902 |
| Molecular Formula | C18H15N3O10 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | dimethyl 5-[[2-(2,4-dinitrophenoxy)acetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H15N3O10/c1-29-17(23)10-5-11(18(24)30-2)7-12(6-10)19-16(22)9-31-15-4-3-13(20(25)26)8-14(15)21(27)28/h3-8H,9H2,1-2H3,(H,19,22) |
| InChIKey | TZBIBPZLJWSGEY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 177.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|