C9H11N2O10P — CID 88813506
[1-(2,4-dinitrophenoxy)-3-hydroxypropan-2-yl] dihydrogen phosphate (PubChem CID 88813506) has the molecular formula C9H11N2O10P and a molecular weight of 338.17 g/mol. Its IUPAC name is [1-(2,4-dinitrophenoxy)-3-hydroxypropan-2-yl] dihydrogen phosphate.
| Compound Name | [1-(2,4-dinitrophenoxy)-3-hydroxypropan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 88813506 |
| Molecular Formula | C9H11N2O10P |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | [1-(2,4-dinitrophenoxy)-3-hydroxypropan-2-yl] dihydrogen phosphate |
| SMILES | O=[N+]([O-])c1ccc(OCC(CO)OP(=O)(O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H11N2O10P/c12-4-7(21-22(17,18)19)5-20-9-2-1-6(10(13)14)3-8(9)11(15)16/h1-3,7,12H,4-5H2,(H2,17,18,19) |
| InChIKey | XILJKONGDNMYGJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 182.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|