C7H6N2O6 — CID 59479964
(2,5-dinitrophenoxy)methanol (PubChem CID 59479964) has the molecular formula C7H6N2O6 and a molecular weight of 214.13 g/mol. Its IUPAC name is (2,5-dinitrophenoxy)methanol.
| Compound Name | (2,5-dinitrophenoxy)methanol |
|---|---|
| PubChem CID | 59479964 |
| Molecular Formula | C7H6N2O6 |
| Molecular Weight | 214.13 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | (2,5-dinitrophenoxy)methanol |
| SMILES | O=[N+]([O-])c1ccc([N+](=O)[O-])c(OCO)c1 |
| InChI | InChI=1S/C7H6N2O6/c10-4-15-7-3-5(8(11)12)1-2-6(7)9(13)14/h1-3,10H,4H2 |
| InChIKey | HBZMWAAKIFWKFY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.13 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|