C12H6N4O9 — CID 139890648
2-(2,5-dinitrophenoxy)-1,4-dinitrobenzene (PubChem CID 139890648) has the molecular formula C12H6N4O9 and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-(2,5-dinitrophenoxy)-1,4-dinitrobenzene.
| Compound Name | 2-(2,5-dinitrophenoxy)-1,4-dinitrobenzene |
|---|---|
| PubChem CID | 139890648 |
| Molecular Formula | C12H6N4O9 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 2-(2,5-dinitrophenoxy)-1,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc([N+](=O)[O-])c(Oc2cc([N+](=O)[O-])ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H6N4O9/c17-13(18)7-1-3-9(15(21)22)11(5-7)25-12-6-8(14(19)20)2-4-10(12)16(23)24/h1-6H |
| InChIKey | WAMSACQKZHBNHZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 181.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|