C16H16N2O7 — CID 24796430
1-(2,5-dinitrophenoxy)-2,5-dimethoxy-3,4-dimethylbenzene (PubChem CID 24796430) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is 1-(2,5-dinitrophenoxy)-2,5-dimethoxy-3,4-dimethylbenzene.
| Compound Name | 1-(2,5-dinitrophenoxy)-2,5-dimethoxy-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 24796430 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 1-(2,5-dinitrophenoxy)-2,5-dimethoxy-3,4-dimethylbenzene |
| SMILES | COc1cc(Oc2cc([N+](=O)[O-])ccc2[N+](=O)[O-])c(OC)c(C)c1C |
| InChI | InChI=1S/C16H16N2O7/c1-9-10(2)16(24-4)15(8-13(9)23-3)25-14-7-11(17(19)20)5-6-12(14)18(21)22/h5-8H,1-4H3 |
| InChIKey | KCQCSFHNPPHGBT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|