C12H8N2O7 — CID 174671523
3-(2,4-dinitrophenoxy)benzene-1,2-diol (PubChem CID 174671523) has the molecular formula C12H8N2O7 and a molecular weight of 292.20 g/mol. Its IUPAC name is 3-(2,4-dinitrophenoxy)benzene-1,2-diol.
| Compound Name | 3-(2,4-dinitrophenoxy)benzene-1,2-diol |
|---|---|
| PubChem CID | 174671523 |
| Molecular Formula | C12H8N2O7 |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 3-(2,4-dinitrophenoxy)benzene-1,2-diol |
| SMILES | O=[N+]([O-])c1ccc(Oc2cccc(O)c2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H8N2O7/c15-9-2-1-3-11(12(9)16)21-10-5-4-7(13(17)18)6-8(10)14(19)20/h1-6,15-16H |
| InChIKey | IRSUZWDBWAKTAY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|