C26H26N4O10 — CID 141160681
2,5-ditert-butyl-1,3-bis(2,4-dinitrophenoxy)benzene (PubChem CID 141160681) has the molecular formula C26H26N4O10 and a molecular weight of 554.51 g/mol. Its IUPAC name is 2,5-ditert-butyl-1,3-bis(2,4-dinitrophenoxy)benzene.
| Compound Name | 2,5-ditert-butyl-1,3-bis(2,4-dinitrophenoxy)benzene |
|---|---|
| PubChem CID | 141160681 |
| Molecular Formula | C26H26N4O10 |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | 2,5-ditert-butyl-1,3-bis(2,4-dinitrophenoxy)benzene |
| SMILES | CC(C)(C)c1cc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(C(C)(C)C)c(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H26N4O10/c1-25(2,3)15-11-22(39-20-9-7-16(27(31)32)13-18(20)29(35)36)24(26(4,5)6)23(12-15)40-21-10-8-17(28(33)34)14-19(21)30(37)38/h7-14H,1-6H3 |
| InChIKey | RFICRZKFSGCLDS-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 191.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|