C20H24N2O5 — CID 154264981
1,4-ditert-butyl-2-(2,4-dinitrophenoxy)benzene (PubChem CID 154264981) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 1,4-ditert-butyl-2-(2,4-dinitrophenoxy)benzene.
| Compound Name | 1,4-ditert-butyl-2-(2,4-dinitrophenoxy)benzene |
|---|---|
| PubChem CID | 154264981 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1,4-ditert-butyl-2-(2,4-dinitrophenoxy)benzene |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N2O5/c1-19(2,3)13-7-9-15(20(4,5)6)18(11-13)27-17-10-8-14(21(23)24)12-16(17)22(25)26/h7-12H,1-6H3 |
| InChIKey | KDGZGZSTAOFJBT-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|