C14H6F6N2O5 — CID 11474942
1-[3,5-bis(trifluoromethyl)phenoxy]-2,4-dinitrobenzene (PubChem CID 11474942) has the molecular formula C14H6F6N2O5 and a molecular weight of 396.20 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenoxy]-2,4-dinitrobenzene.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenoxy]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 11474942 |
| Molecular Formula | C14H6F6N2O5 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenoxy]-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(Oc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H6F6N2O5/c15-13(16,17)7-3-8(14(18,19)20)5-10(4-7)27-12-2-1-9(21(23)24)6-11(12)22(25)26/h1-6H |
| InChIKey | YAPGUHQATZHQLK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|