C16H15BN2O5 — CID 175507551
2-[4-(2,4-dinitrophenoxy)phenyl]ethenyl-dimethylborane (PubChem CID 175507551) has the molecular formula C16H15BN2O5 and a molecular weight of 326.12 g/mol. Its IUPAC name is 2-[4-(2,4-dinitrophenoxy)phenyl]ethenyl-dimethylborane.
| Compound Name | 2-[4-(2,4-dinitrophenoxy)phenyl]ethenyl-dimethylborane |
|---|---|
| PubChem CID | 175507551 |
| Molecular Formula | C16H15BN2O5 |
| Molecular Weight | 326.12 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-[4-(2,4-dinitrophenoxy)phenyl]ethenyl-dimethylborane |
| SMILES | CB(C)C=Cc1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H15BN2O5/c1-17(2)10-9-12-3-6-14(7-4-12)24-16-8-5-13(18(20)21)11-15(16)19(22)23/h3-11H,1-2H3 |
| InChIKey | JVBUEQFOFYOEBX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.12 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|