C19H15N3O8S — CID 126151380
(5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126151380) has the molecular formula C19H15N3O8S and a molecular weight of 445.41 g/mol. Its IUPAC name is (5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126151380 |
| Molecular Formula | C19H15N3O8S |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | (5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-3-(2-methoxyethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COCCN1C(=O)S/C(=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C19H15N3O8S/c1-29-9-8-20-18(23)17(31-19(20)24)10-12-2-5-14(6-3-12)30-16-7-4-13(21(25)26)11-15(16)22(27)28/h2-7,10-11H,8-9H2,1H3/b17-10+ |
| InChIKey | PXPGTEWPQCIYON-LICLKQGHSA-N |
| XLogP | 3.98 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|