C24H14BrClN4O8S — CID 126208186
N-(4-bromo-3-chlorophenyl)-2-[(5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126208186) has the molecular formula C24H14BrClN4O8S and a molecular weight of 633.82 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)-2-[(5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(4-bromo-3-chlorophenyl)-2-[(5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126208186 |
| Molecular Formula | C24H14BrClN4O8S |
| Molecular Weight | 633.82 g/mol |
| Exact Mass | 631.94 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)-2-[(5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2)C1=O)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C24H14BrClN4O8S/c25-17-7-3-14(10-18(17)26)27-22(31)12-28-23(32)21(39-24(28)33)9-13-1-5-16(6-2-13)38-20-8-4-15(29(34)35)11-19(20)30(36)37/h1-11H,12H2,(H,27,31)/b21-9+ |
| InChIKey | RPPGHABPOOEMQN-ZVBGSRNCSA-N |
| XLogP | 6.39 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.82 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|