C26H20N4O8S — CID 126188324
2-[(5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 126188324) has the molecular formula C26H20N4O8S and a molecular weight of 548.53 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 126188324 |
| Molecular Formula | C26H20N4O8S |
| Molecular Weight | 548.53 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | 2-[(5E)-5-[[4-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CN2C(=O)S/C(=C/c3ccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H20N4O8S/c1-2-16-3-7-18(8-4-16)27-24(31)15-28-25(32)23(39-26(28)33)13-17-5-10-20(11-6-17)38-22-12-9-19(29(34)35)14-21(22)30(36)37/h3-14H,2,15H2,1H3,(H,27,31)/b23-13+ |
| InChIKey | IFERSNMWPPIUKO-YDZHTSKRSA-N |
| XLogP | 5.53 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|