C25H17ClN4O9S — CID 126275752
N-(3-chloro-4-methoxyphenyl)-2-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126275752) has the molecular formula C25H17ClN4O9S and a molecular weight of 584.95 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126275752 |
| Molecular Formula | C25H17ClN4O9S |
| Molecular Weight | 584.95 g/mol |
| Exact Mass | 584.04 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)S/C(=C/c3cccc(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])c3)C2=O)cc1Cl |
| InChI | InChI=1S/C25H17ClN4O9S/c1-38-20-7-5-15(11-18(20)26)27-23(31)13-28-24(32)22(40-25(28)33)10-14-3-2-4-17(9-14)39-21-8-6-16(29(34)35)12-19(21)30(36)37/h2-12H,13H2,1H3,(H,27,31)/b22-10+ |
| InChIKey | CVZQMWINDHDSPI-LSHDLFTRSA-N |
| XLogP | 5.63 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.95 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|