C25H18N4O9S — CID 126275948
2-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126275948) has the molecular formula C25H18N4O9S and a molecular weight of 550.51 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126275948 |
| Molecular Formula | C25H18N4O9S |
| Molecular Weight | 550.51 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | 2-[(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)S/C(=C/c2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C25H18N4O9S/c1-37-20-8-3-2-7-18(20)26-23(30)14-27-24(31)22(39-25(27)32)12-15-5-4-6-17(11-15)38-21-10-9-16(28(33)34)13-19(21)29(35)36/h2-13H,14H2,1H3,(H,26,30)/b22-12+ |
| InChIKey | DQTFMSFUWLSFIL-WSDLNYQXSA-N |
| XLogP | 4.98 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|