C23H20N4O8S — CID 124643496
(5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 124643496) has the molecular formula C23H20N4O8S and a molecular weight of 512.50 g/mol. Its IUPAC name is (5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 124643496 |
| Molecular Formula | C23H20N4O8S |
| Molecular Weight | 512.50 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | (5E)-5-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]-3-(2-oxo-2-piperidin-1-ylethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(CN1C(=O)S/C(=C/c2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)C1=O)N1CCCCC1 |
| InChI | InChI=1S/C23H20N4O8S/c28-21(24-9-2-1-3-10-24)14-25-22(29)20(36-23(25)30)12-15-5-4-6-17(11-15)35-19-8-7-16(26(31)32)13-18(19)27(33)34/h4-8,11-13H,1-3,9-10,14H2/b20-12+ |
| InChIKey | LMXWUUJJJWEDBT-UDWIEESQSA-N |
| XLogP | 4.34 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|